C24H26FN3O3 — CID 45107077
2-[(2Z)-2-[(2-fluorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-(3-pyrrolidin-1-ylpropyl)acetamide (PubChem CID 45107077) has the molecular formula C24H26FN3O3 and a molecular weight of 423.49 g/mol. Its IUPAC name is 2-[(2Z)-2-[(2-fluorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-(3-pyrrolidin-1-ylpropyl)acetamide.
| Compound Name | 2-[(2Z)-2-[(2-fluorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-(3-pyrrolidin-1-ylpropyl)acetamide |
|---|---|
| PubChem CID | 45107077 |
| Molecular Formula | C24H26FN3O3 |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 2-[(2Z)-2-[(2-fluorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-(3-pyrrolidin-1-ylpropyl)acetamide |
| SMILES | O=C(CN1C(=O)/C(=C/c2ccccc2F)Oc2ccccc21)NCCCN1CCCC1 |
| InChI | InChI=1S/C24H26FN3O3/c25-19-9-2-1-8-18(19)16-22-24(30)28(20-10-3-4-11-21(20)31-22)17-23(29)26-12-7-15-27-13-5-6-14-27/h1-4,8-11,16H,5-7,12-15,17H2,(H,26,29)/b22-16- |
| InChIKey | YXNQIMHECDATPD-JWGURIENSA-N |
| XLogP | 3.19 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|