C25H27FN2O3 — CID 98663545
N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2-[(2Z)-2-[(2-fluorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]acetamide (PubChem CID 98663545) has the molecular formula C25H27FN2O3 and a molecular weight of 422.50 g/mol. Its IUPAC name is N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2-[(2Z)-2-[(2-fluorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]acetamide.
| Compound Name | N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2-[(2Z)-2-[(2-fluorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]acetamide |
|---|---|
| PubChem CID | 98663545 |
| Molecular Formula | C25H27FN2O3 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2-[(2Z)-2-[(2-fluorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]acetamide |
| SMILES | C[C@H]1[C@H](C)CCC[C@H]1NC(=O)CN1C(=O)/C(=C/c2ccccc2F)Oc2ccccc21 |
| InChI | InChI=1S/C25H27FN2O3/c1-16-8-7-11-20(17(16)2)27-24(29)15-28-21-12-5-6-13-22(21)31-23(25(28)30)14-18-9-3-4-10-19(18)26/h3-6,9-10,12-14,16-17,20H,7-8,11,15H2,1-2H3,(H,27,29)/b23-14-/t16-,17+,20-/m1/s1 |
| InChIKey | JIPISVFKIMZGIU-XIZAQAEBSA-N |
| XLogP | 4.53 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|