C25H28N2O3 — CID 124771845
N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-4-[(Z)-(4-methyl-3-oxo-1,4-benzoxazin-2-ylidene)methyl]benzamide (PubChem CID 124771845) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-4-[(Z)-(4-methyl-3-oxo-1,4-benzoxazin-2-ylidene)methyl]benzamide.
| Compound Name | N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-4-[(Z)-(4-methyl-3-oxo-1,4-benzoxazin-2-ylidene)methyl]benzamide |
|---|---|
| PubChem CID | 124771845 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-4-[(Z)-(4-methyl-3-oxo-1,4-benzoxazin-2-ylidene)methyl]benzamide |
| SMILES | C[C@H]1[C@H](C)CCC[C@H]1NC(=O)c1ccc(/C=C2\Oc3ccccc3N(C)C2=O)cc1 |
| InChI | InChI=1S/C25H28N2O3/c1-16-7-6-8-20(17(16)2)26-24(28)19-13-11-18(12-14-19)15-23-25(29)27(3)21-9-4-5-10-22(21)30-23/h4-5,9-17,20H,6-8H2,1-3H3,(H,26,28)/b23-15-/t16-,17+,20-/m1/s1 |
| InChIKey | DFAKFZFFWLOLLO-NOXAFCSXSA-N |
| XLogP | 4.64 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|