C31H31FN2O3 — CID 92656998
N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-4-[(Z)-[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]benzamide (PubChem CID 92656998) has the molecular formula C31H31FN2O3 and a molecular weight of 498.60 g/mol. Its IUPAC name is N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-4-[(Z)-[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]benzamide.
| Compound Name | N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-4-[(Z)-[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]benzamide |
|---|---|
| PubChem CID | 92656998 |
| Molecular Formula | C31H31FN2O3 |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-4-[(Z)-[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]benzamide |
| SMILES | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)c1ccc(/C=C2\Oc3ccccc3N(Cc3ccccc3F)C2=O)cc1 |
| InChI | InChI=1S/C31H31FN2O3/c1-20-8-7-11-26(21(20)2)33-30(35)23-16-14-22(15-17-23)18-29-31(36)34(19-24-9-3-4-10-25(24)32)27-12-5-6-13-28(27)37-29/h3-6,9-10,12-18,20-21,26H,7-8,11,19H2,1-2H3,(H,33,35)/b29-18-/t20-,21-,26+/m1/s1 |
| InChIKey | MLRUPQVVBAPADZ-HRODBUPESA-N |
| XLogP | 6.35 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|