C29H29FN2O3S — CID 129428533
(11S)-N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-5-[(2-fluorophenyl)methyl]-6,11-dioxobenzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 129428533) has the molecular formula C29H29FN2O3S and a molecular weight of 504.63 g/mol. Its IUPAC name is (11S)-N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-5-[(2-fluorophenyl)methyl]-6,11-dioxobenzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | (11S)-N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-5-[(2-fluorophenyl)methyl]-6,11-dioxobenzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 129428533 |
| Molecular Formula | C29H29FN2O3S |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | (11S)-N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-5-[(2-fluorophenyl)methyl]-6,11-dioxobenzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | C[C@H]1[C@H](C)CCC[C@@H]1NC(=O)c1ccc2c(c1)N(Cc1ccccc1F)C(=O)c1ccccc1[S@@]2=O |
| InChI | InChI=1S/C29H29FN2O3S/c1-18-8-7-12-24(19(18)2)31-28(33)20-14-15-27-25(16-20)32(17-21-9-3-5-11-23(21)30)29(34)22-10-4-6-13-26(22)36(27)35/h3-6,9-11,13-16,18-19,24H,7-8,12,17H2,1-2H3,(H,31,33)/t18-,19+,24+,36+/m1/s1 |
| InChIKey | PQGMBFLDZRUNBO-XJRKKXQYSA-N |
| XLogP | 5.71 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |