C32H38FN3O3S — CID 46255340
N-[3-[bis(2-methylpropyl)amino]propyl]-5-[(2-fluorophenyl)methyl]-6,11-dioxobenzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 46255340) has the molecular formula C32H38FN3O3S and a molecular weight of 563.74 g/mol. Its IUPAC name is N-[3-[bis(2-methylpropyl)amino]propyl]-5-[(2-fluorophenyl)methyl]-6,11-dioxobenzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | N-[3-[bis(2-methylpropyl)amino]propyl]-5-[(2-fluorophenyl)methyl]-6,11-dioxobenzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 46255340 |
| Molecular Formula | C32H38FN3O3S |
| Molecular Weight | 563.74 g/mol |
| Exact Mass | 563.26 |
| IUPAC Name | N-[3-[bis(2-methylpropyl)amino]propyl]-5-[(2-fluorophenyl)methyl]-6,11-dioxobenzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | CC(C)CN(CCCNC(=O)c1ccc2c(c1)N(Cc1ccccc1F)C(=O)c1ccccc1S2=O)CC(C)C |
| InChI | InChI=1S/C32H38FN3O3S/c1-22(2)19-35(20-23(3)4)17-9-16-34-31(37)24-14-15-30-28(18-24)36(21-25-10-5-7-12-27(25)33)32(38)26-11-6-8-13-29(26)40(30)39/h5-8,10-15,18,22-23H,9,16-17,19-21H2,1-4H3,(H,34,37) |
| InChIKey | NQPKHZDPCXYXIN-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.74 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|