C32H38ClN3O3S — CID 94486680
(11R)-N-[3-[bis(2-methylpropyl)amino]propyl]-5-[(3-chlorophenyl)methyl]-6,11-dioxobenzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 94486680) has the molecular formula C32H38ClN3O3S and a molecular weight of 580.19 g/mol. Its IUPAC name is (11R)-N-[3-[bis(2-methylpropyl)amino]propyl]-5-[(3-chlorophenyl)methyl]-6,11-dioxobenzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | (11R)-N-[3-[bis(2-methylpropyl)amino]propyl]-5-[(3-chlorophenyl)methyl]-6,11-dioxobenzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 94486680 |
| Molecular Formula | C32H38ClN3O3S |
| Molecular Weight | 580.19 g/mol |
| Exact Mass | 579.23 |
| IUPAC Name | (11R)-N-[3-[bis(2-methylpropyl)amino]propyl]-5-[(3-chlorophenyl)methyl]-6,11-dioxobenzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | CC(C)CN(CCCNC(=O)c1ccc2c(c1)N(Cc1cccc(Cl)c1)C(=O)c1ccccc1[S@]2=O)CC(C)C |
| InChI | InChI=1S/C32H38ClN3O3S/c1-22(2)19-35(20-23(3)4)16-8-15-34-31(37)25-13-14-30-28(18-25)36(21-24-9-7-10-26(33)17-24)32(38)27-11-5-6-12-29(27)40(30)39/h5-7,9-14,17-18,22-23H,8,15-16,19-21H2,1-4H3,(H,34,37)/t40-/m1/s1 |
| InChIKey | PTFRJGLKGAZHQW-RRHRGVEJSA-N |
| XLogP | 6.40 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.19 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|