C28H26ClN3O4S — CID 94486675
(11R)-5-[(3-chlorophenyl)methyl]-6,11-dioxo-N-[3-(2-oxopyrrolidin-1-yl)propyl]benzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 94486675) has the molecular formula C28H26ClN3O4S and a molecular weight of 536.05 g/mol. Its IUPAC name is (11R)-5-[(3-chlorophenyl)methyl]-6,11-dioxo-N-[3-(2-oxopyrrolidin-1-yl)propyl]benzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | (11R)-5-[(3-chlorophenyl)methyl]-6,11-dioxo-N-[3-(2-oxopyrrolidin-1-yl)propyl]benzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 94486675 |
| Molecular Formula | C28H26ClN3O4S |
| Molecular Weight | 536.05 g/mol |
| Exact Mass | 535.13 |
| IUPAC Name | (11R)-5-[(3-chlorophenyl)methyl]-6,11-dioxo-N-[3-(2-oxopyrrolidin-1-yl)propyl]benzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | O=C(NCCCN1CCCC1=O)c1ccc2c(c1)N(Cc1cccc(Cl)c1)C(=O)c1ccccc1[S@]2=O |
| InChI | InChI=1S/C28H26ClN3O4S/c29-21-7-3-6-19(16-21)18-32-23-17-20(27(34)30-13-5-15-31-14-4-10-26(31)33)11-12-25(23)37(36)24-9-2-1-8-22(24)28(32)35/h1-3,6-9,11-12,16-17H,4-5,10,13-15,18H2,(H,30,34)/t37-/m1/s1 |
| InChIKey | QUPHQXITQKTRMS-DIPNUNPCSA-N |
| XLogP | 4.41 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.05 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|