C26H25ClN2O4S — CID 3496922
5-[(3-chlorophenyl)methyl]-N-(3-ethoxypropyl)-6,11-dioxobenzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 3496922) has the molecular formula C26H25ClN2O4S and a molecular weight of 497.02 g/mol. Its IUPAC name is 5-[(3-chlorophenyl)methyl]-N-(3-ethoxypropyl)-6,11-dioxobenzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | 5-[(3-chlorophenyl)methyl]-N-(3-ethoxypropyl)-6,11-dioxobenzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 3496922 |
| Molecular Formula | C26H25ClN2O4S |
| Molecular Weight | 497.02 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | 5-[(3-chlorophenyl)methyl]-N-(3-ethoxypropyl)-6,11-dioxobenzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | CCOCCCNC(=O)c1ccc2c(c1)N(Cc1cccc(Cl)c1)C(=O)c1ccccc1S2=O |
| InChI | InChI=1S/C26H25ClN2O4S/c1-2-33-14-6-13-28-25(30)19-11-12-24-22(16-19)29(17-18-7-5-8-20(27)15-18)26(31)21-9-3-4-10-23(21)34(24)32/h3-5,7-12,15-16H,2,6,13-14,17H2,1H3,(H,28,30) |
| InChIKey | OFVIRKJFGUDLTH-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.02 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|