C34H38FN3O3 — CID 143974458
1-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-N-methylmethanamine;4-[(Z)-[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]benzaldehyde (PubChem CID 143974458) has the molecular formula C34H38FN3O3 and a molecular weight of 555.69 g/mol. Its IUPAC name is 1-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-N-methylmethanamine;4-[(Z)-[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]benzaldehyde.
| Compound Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-N-methylmethanamine;4-[(Z)-[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]benzaldehyde |
|---|---|
| PubChem CID | 143974458 |
| Molecular Formula | C34H38FN3O3 |
| Molecular Weight | 555.69 g/mol |
| Exact Mass | 555.29 |
| IUPAC Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-N-methylmethanamine;4-[(Z)-[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]benzaldehyde |
| SMILES | CNCN1CCC2CCCCC2C1.O=Cc1ccc(/C=C2\Oc3ccccc3N(Cc3ccccc3F)C2=O)cc1 |
| InChI | InChI=1S/C23H16FNO3.C11H22N2/c24-19-6-2-1-5-18(19)14-25-20-7-3-4-8-21(20)28-22(23(25)27)13-16-9-11-17(15-26)12-10-16;1-12-9-13-7-6-10-4-2-3-5-11(10)8-13/h1-13,15H,14H2;10-12H,2-9H2,1H3/b22-13-; |
| InChIKey | IYJPPQYGXIDCEP-BWLGBDCWSA-N |
| XLogP | 6.28 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.69 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|