C31H30F3N3O3 — CID 45280139
4-[(Z)-[3-oxo-4-[[2-(trifluoromethyl)phenyl]methyl]-1,4-benzoxazin-2-ylidene]methyl]-N-(3-pyrrolidin-1-ylpropyl)benzamide (PubChem CID 45280139) has the molecular formula C31H30F3N3O3 and a molecular weight of 549.59 g/mol. Its IUPAC name is 4-[(Z)-[3-oxo-4-[[2-(trifluoromethyl)phenyl]methyl]-1,4-benzoxazin-2-ylidene]methyl]-N-(3-pyrrolidin-1-ylpropyl)benzamide.
| Compound Name | 4-[(Z)-[3-oxo-4-[[2-(trifluoromethyl)phenyl]methyl]-1,4-benzoxazin-2-ylidene]methyl]-N-(3-pyrrolidin-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 45280139 |
| Molecular Formula | C31H30F3N3O3 |
| Molecular Weight | 549.59 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | 4-[(Z)-[3-oxo-4-[[2-(trifluoromethyl)phenyl]methyl]-1,4-benzoxazin-2-ylidene]methyl]-N-(3-pyrrolidin-1-ylpropyl)benzamide |
| SMILES | O=C(NCCCN1CCCC1)c1ccc(/C=C2\Oc3ccccc3N(Cc3ccccc3C(F)(F)F)C2=O)cc1 |
| InChI | InChI=1S/C31H30F3N3O3/c32-31(33,34)25-9-2-1-8-24(25)21-37-26-10-3-4-11-27(26)40-28(30(37)39)20-22-12-14-23(15-13-22)29(38)35-16-7-19-36-17-5-6-18-36/h1-4,8-15,20H,5-7,16-19,21H2,(H,35,38)/b28-20- |
| InChIKey | JKNVEXJZOJCWFQ-RRAHZORUSA-N |
| XLogP | 5.89 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.59 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|