C31H34N2O3S — CID 4249812
N-(3-butylsulfanylpropyl)-4-[[4-[(4-methylphenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]benzamide (PubChem CID 4249812) has the molecular formula C31H34N2O3S and a molecular weight of 514.69 g/mol. Its IUPAC name is N-(3-butylsulfanylpropyl)-4-[[4-[(4-methylphenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]benzamide.
| Compound Name | N-(3-butylsulfanylpropyl)-4-[[4-[(4-methylphenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]benzamide |
|---|---|
| PubChem CID | 4249812 |
| Molecular Formula | C31H34N2O3S |
| Molecular Weight | 514.69 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | N-(3-butylsulfanylpropyl)-4-[[4-[(4-methylphenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]benzamide |
| SMILES | CCCCSCCCNC(=O)c1ccc(C=C2Oc3ccccc3N(Cc3ccc(C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C31H34N2O3S/c1-3-4-19-37-20-7-18-32-30(34)26-16-14-24(15-17-26)21-29-31(35)33(22-25-12-10-23(2)11-13-25)27-8-5-6-9-28(27)36-29/h5-6,8-17,21H,3-4,7,18-20,22H2,1-2H3,(H,32,34) |
| InChIKey | GGIYMYIDTUAJBI-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.69 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|