C33H37N3O3 — CID 6047357
4-[(E)-[4-[(4-methylphenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]-N-[3-(4-methylpiperidin-1-yl)propyl]benzamide (PubChem CID 6047357) has the molecular formula C33H37N3O3 and a molecular weight of 523.68 g/mol. Its IUPAC name is 4-[(E)-[4-[(4-methylphenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]-N-[3-(4-methylpiperidin-1-yl)propyl]benzamide.
| Compound Name | 4-[(E)-[4-[(4-methylphenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]-N-[3-(4-methylpiperidin-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 6047357 |
| Molecular Formula | C33H37N3O3 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | 4-[(E)-[4-[(4-methylphenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]-N-[3-(4-methylpiperidin-1-yl)propyl]benzamide |
| SMILES | Cc1ccc(CN2C(=O)/C(=C\c3ccc(C(=O)NCCCN4CCC(C)CC4)cc3)Oc3ccccc32)cc1 |
| InChI | InChI=1S/C33H37N3O3/c1-24-8-10-27(11-9-24)23-36-29-6-3-4-7-30(29)39-31(33(36)38)22-26-12-14-28(15-13-26)32(37)34-18-5-19-35-20-16-25(2)17-21-35/h3-4,6-15,22,25H,5,16-21,23H2,1-2H3,(H,34,37)/b31-22+ |
| InChIKey | URMIKNPHUNACSZ-DFKUXCBWSA-N |
| XLogP | 5.81 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|