C26H21FN2O3 — CID 3494888
N-cyclopropyl-4-[[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]benzamide (PubChem CID 3494888) has the molecular formula C26H21FN2O3 and a molecular weight of 428.46 g/mol. Its IUPAC name is N-cyclopropyl-4-[[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]benzamide.
| Compound Name | N-cyclopropyl-4-[[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]benzamide |
|---|---|
| PubChem CID | 3494888 |
| Molecular Formula | C26H21FN2O3 |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | N-cyclopropyl-4-[[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzoxazin-2-ylidene]methyl]benzamide |
| SMILES | O=C(NC1CC1)c1ccc(C=C2Oc3ccccc3N(Cc3ccccc3F)C2=O)cc1 |
| InChI | InChI=1S/C26H21FN2O3/c27-21-6-2-1-5-19(21)16-29-22-7-3-4-8-23(22)32-24(26(29)31)15-17-9-11-18(12-10-17)25(30)28-20-13-14-20/h1-12,15,20H,13-14,16H2,(H,28,30) |
| InChIKey | YCVSQXAWCQFBAW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|