C23H24BrN3O3 — CID 6002597
2-[(2E)-2-[(3-bromophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-(2-pyrrolidin-1-ylethyl)acetamide (PubChem CID 6002597) has the molecular formula C23H24BrN3O3 and a molecular weight of 470.37 g/mol. Its IUPAC name is 2-[(2E)-2-[(3-bromophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-(2-pyrrolidin-1-ylethyl)acetamide.
| Compound Name | 2-[(2E)-2-[(3-bromophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-(2-pyrrolidin-1-ylethyl)acetamide |
|---|---|
| PubChem CID | 6002597 |
| Molecular Formula | C23H24BrN3O3 |
| Molecular Weight | 470.37 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | 2-[(2E)-2-[(3-bromophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-(2-pyrrolidin-1-ylethyl)acetamide |
| SMILES | O=C(CN1C(=O)/C(=C\c2cccc(Br)c2)Oc2ccccc21)NCCN1CCCC1 |
| InChI | InChI=1S/C23H24BrN3O3/c24-18-7-5-6-17(14-18)15-21-23(29)27(19-8-1-2-9-20(19)30-21)16-22(28)25-10-13-26-11-3-4-12-26/h1-2,5-9,14-15H,3-4,10-13,16H2,(H,25,28)/b21-15+ |
| InChIKey | QZJNXYWSNSENNF-RCCKNPSSSA-N |
| XLogP | 3.43 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|