C27H32ClN3O3 — CID 6260339
2-[(2E)-6-tert-butyl-2-[(4-chlorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-(2-pyrrolidin-1-ylethyl)acetamide (PubChem CID 6260339) has the molecular formula C27H32ClN3O3 and a molecular weight of 482.02 g/mol. Its IUPAC name is 2-[(2E)-6-tert-butyl-2-[(4-chlorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-(2-pyrrolidin-1-ylethyl)acetamide.
| Compound Name | 2-[(2E)-6-tert-butyl-2-[(4-chlorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-(2-pyrrolidin-1-ylethyl)acetamide |
|---|---|
| PubChem CID | 6260339 |
| Molecular Formula | C27H32ClN3O3 |
| Molecular Weight | 482.02 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 2-[(2E)-6-tert-butyl-2-[(4-chlorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-(2-pyrrolidin-1-ylethyl)acetamide |
| SMILES | CC(C)(C)c1ccc2c(c1)N(CC(=O)NCCN1CCCC1)C(=O)/C(=C\c1ccc(Cl)cc1)O2 |
| InChI | InChI=1S/C27H32ClN3O3/c1-27(2,3)20-8-11-23-22(17-20)31(18-25(32)29-12-15-30-13-4-5-14-30)26(33)24(34-23)16-19-6-9-21(28)10-7-19/h6-11,16-17H,4-5,12-15,18H2,1-3H3,(H,29,32)/b24-16+ |
| InChIKey | ZEZOBVCUPLISHC-LFVJCYFKSA-N |
| XLogP | 4.62 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.02 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|