C26H29ClN2O4 — CID 46372777
2-[(2E)-6-tert-butyl-2-[(4-chlorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 46372777) has the molecular formula C26H29ClN2O4 and a molecular weight of 468.98 g/mol. Its IUPAC name is 2-[(2E)-6-tert-butyl-2-[(4-chlorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-[(2E)-6-tert-butyl-2-[(4-chlorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 46372777 |
| Molecular Formula | C26H29ClN2O4 |
| Molecular Weight | 468.98 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 2-[(2E)-6-tert-butyl-2-[(4-chlorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | CC(C)(C)c1ccc2c(c1)N(CC(=O)NCC1CCCO1)C(=O)/C(=C\c1ccc(Cl)cc1)O2 |
| InChI | InChI=1S/C26H29ClN2O4/c1-26(2,3)18-8-11-22-21(14-18)29(16-24(30)28-15-20-5-4-12-32-20)25(31)23(33-22)13-17-6-9-19(27)10-7-17/h6-11,13-14,20H,4-5,12,15-16H2,1-3H3,(H,28,30)/b23-13+ |
| InChIKey | TVZFBRRXISDDKG-YDZHTSKRSA-N |
| XLogP | 4.70 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.98 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|