C19H21ClN2O6S — CID 126216201
2-[(5Z)-5-[(2-chloro-4,5-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[[(2S)-oxolan-2-yl]methyl]acetamide (PubChem CID 126216201) has the molecular formula C19H21ClN2O6S and a molecular weight of 440.91 g/mol. Its IUPAC name is 2-[(5Z)-5-[(2-chloro-4,5-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[[(2S)-oxolan-2-yl]methyl]acetamide.
| Compound Name | 2-[(5Z)-5-[(2-chloro-4,5-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[[(2S)-oxolan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 126216201 |
| Molecular Formula | C19H21ClN2O6S |
| Molecular Weight | 440.91 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 2-[(5Z)-5-[(2-chloro-4,5-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[[(2S)-oxolan-2-yl]methyl]acetamide |
| SMILES | COc1cc(Cl)c(/C=C2\SC(=O)N(CC(=O)NC[C@@H]3CCCO3)C2=O)cc1OC |
| InChI | InChI=1S/C19H21ClN2O6S/c1-26-14-6-11(13(20)8-15(14)27-2)7-16-18(24)22(19(25)29-16)10-17(23)21-9-12-4-3-5-28-12/h6-8,12H,3-5,9-10H2,1-2H3,(H,21,23)/b16-7-/t12-/m0/s1 |
| InChIKey | HQLKDPRVSLGHRL-VQZCYCSMSA-N |
| XLogP | 2.69 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.91 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|