C28H27Cl2N3O4S — CID 126149558
2-[3-[(Z)-[3-[(3,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-7-ethylindol-1-yl]-N-[[(2S)-oxolan-2-yl]methyl]acetamide (PubChem CID 126149558) has the molecular formula C28H27Cl2N3O4S and a molecular weight of 572.51 g/mol. Its IUPAC name is 2-[3-[(Z)-[3-[(3,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-7-ethylindol-1-yl]-N-[[(2S)-oxolan-2-yl]methyl]acetamide.
| Compound Name | 2-[3-[(Z)-[3-[(3,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-7-ethylindol-1-yl]-N-[[(2S)-oxolan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 126149558 |
| Molecular Formula | C28H27Cl2N3O4S |
| Molecular Weight | 572.51 g/mol |
| Exact Mass | 571.11 |
| IUPAC Name | 2-[3-[(Z)-[3-[(3,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-7-ethylindol-1-yl]-N-[[(2S)-oxolan-2-yl]methyl]acetamide |
| SMILES | CCc1cccc2c(/C=C3\SC(=O)N(Cc4ccc(Cl)c(Cl)c4)C3=O)cn(CC(=O)NC[C@@H]3CCCO3)c12 |
| InChI | InChI=1S/C28H27Cl2N3O4S/c1-2-18-5-3-7-21-19(15-32(26(18)21)16-25(34)31-13-20-6-4-10-37-20)12-24-27(35)33(28(36)38-24)14-17-8-9-22(29)23(30)11-17/h3,5,7-9,11-12,15,20H,2,4,6,10,13-14,16H2,1H3,(H,31,34)/b24-12-/t20-/m0/s1 |
| InChIKey | MMCWFNKCDIBTGE-QMFCMINHSA-N |
| XLogP | 6.04 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.51 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|