C25H31N3O4S — CID 126137151
2-[7-ethyl-3-[(Z)-[3-(2-methylpropyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-[[(2S)-oxolan-2-yl]methyl]acetamide (PubChem CID 126137151) has the molecular formula C25H31N3O4S and a molecular weight of 469.61 g/mol. Its IUPAC name is 2-[7-ethyl-3-[(Z)-[3-(2-methylpropyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-[[(2S)-oxolan-2-yl]methyl]acetamide.
| Compound Name | 2-[7-ethyl-3-[(Z)-[3-(2-methylpropyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-[[(2S)-oxolan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 126137151 |
| Molecular Formula | C25H31N3O4S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 2-[7-ethyl-3-[(Z)-[3-(2-methylpropyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-[[(2S)-oxolan-2-yl]methyl]acetamide |
| SMILES | CCc1cccc2c(/C=C3\SC(=O)N(CC(C)C)C3=O)cn(CC(=O)NC[C@@H]3CCCO3)c12 |
| InChI | InChI=1S/C25H31N3O4S/c1-4-17-7-5-9-20-18(11-21-24(30)28(13-16(2)3)25(31)33-21)14-27(23(17)20)15-22(29)26-12-19-8-6-10-32-19/h5,7,9,11,14,16,19H,4,6,8,10,12-13,15H2,1-3H3,(H,26,29)/b21-11-/t19-/m0/s1 |
| InChIKey | VDWLOLNMGLSOOD-POJBONIESA-N |
| XLogP | 4.19 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|