C27H27N3O5S — CID 126141157
2-[3-[(Z)-(2,4-dioxo-3-phenacyl-1,3-thiazolidin-5-ylidene)methyl]-7-ethylindol-1-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 126141157) has the molecular formula C27H27N3O5S and a molecular weight of 505.60 g/mol. Its IUPAC name is 2-[3-[(Z)-(2,4-dioxo-3-phenacyl-1,3-thiazolidin-5-ylidene)methyl]-7-ethylindol-1-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[3-[(Z)-(2,4-dioxo-3-phenacyl-1,3-thiazolidin-5-ylidene)methyl]-7-ethylindol-1-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 126141157 |
| Molecular Formula | C27H27N3O5S |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | 2-[3-[(Z)-(2,4-dioxo-3-phenacyl-1,3-thiazolidin-5-ylidene)methyl]-7-ethylindol-1-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | CCc1cccc2c(/C=C3\SC(=O)N(CC(=O)c4ccccc4)C3=O)cn(CC(=O)NCCOC)c12 |
| InChI | InChI=1S/C27H27N3O5S/c1-3-18-10-7-11-21-20(15-29(25(18)21)17-24(32)28-12-13-35-2)14-23-26(33)30(27(34)36-23)16-22(31)19-8-5-4-6-9-19/h4-11,14-15H,3,12-13,16-17H2,1-2H3,(H,28,32)/b23-14- |
| InChIKey | PUYORCHTJYZPTK-UCQKPKSFSA-N |
| XLogP | 3.89 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|