C27H27Cl2N3O4S — CID 126141547
2-[3-[(Z)-[3-[(2,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-7-ethylindol-1-yl]-N-(3-methoxypropyl)acetamide (PubChem CID 126141547) has the molecular formula C27H27Cl2N3O4S and a molecular weight of 560.50 g/mol. Its IUPAC name is 2-[3-[(Z)-[3-[(2,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-7-ethylindol-1-yl]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[3-[(Z)-[3-[(2,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-7-ethylindol-1-yl]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 126141547 |
| Molecular Formula | C27H27Cl2N3O4S |
| Molecular Weight | 560.50 g/mol |
| Exact Mass | 559.11 |
| IUPAC Name | 2-[3-[(Z)-[3-[(2,4-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-7-ethylindol-1-yl]-N-(3-methoxypropyl)acetamide |
| SMILES | CCc1cccc2c(/C=C3\SC(=O)N(Cc4ccc(Cl)cc4Cl)C3=O)cn(CC(=O)NCCCOC)c12 |
| InChI | InChI=1S/C27H27Cl2N3O4S/c1-3-17-6-4-7-21-19(14-31(25(17)21)16-24(33)30-10-5-11-36-2)12-23-26(34)32(27(35)37-23)15-18-8-9-20(28)13-22(18)29/h4,6-9,12-14H,3,5,10-11,15-16H2,1-2H3,(H,30,33)/b23-12- |
| InChIKey | UBEBQVOQVMGEBC-FMCGGJTJSA-N |
| XLogP | 5.90 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.50 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|