C23H29N3O4S — CID 126131391
2-[3-[(Z)-(2,4-dioxo-3-propan-2-yl-1,3-thiazolidin-5-ylidene)methyl]-7-ethylindol-1-yl]-N-(3-methoxypropyl)acetamide (PubChem CID 126131391) has the molecular formula C23H29N3O4S and a molecular weight of 443.57 g/mol. Its IUPAC name is 2-[3-[(Z)-(2,4-dioxo-3-propan-2-yl-1,3-thiazolidin-5-ylidene)methyl]-7-ethylindol-1-yl]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[3-[(Z)-(2,4-dioxo-3-propan-2-yl-1,3-thiazolidin-5-ylidene)methyl]-7-ethylindol-1-yl]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 126131391 |
| Molecular Formula | C23H29N3O4S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 2-[3-[(Z)-(2,4-dioxo-3-propan-2-yl-1,3-thiazolidin-5-ylidene)methyl]-7-ethylindol-1-yl]-N-(3-methoxypropyl)acetamide |
| SMILES | CCc1cccc2c(/C=C3\SC(=O)N(C(C)C)C3=O)cn(CC(=O)NCCCOC)c12 |
| InChI | InChI=1S/C23H29N3O4S/c1-5-16-8-6-9-18-17(12-19-22(28)26(15(2)3)23(29)31-19)13-25(21(16)18)14-20(27)24-10-7-11-30-4/h6,8-9,12-13,15H,5,7,10-11,14H2,1-4H3,(H,24,27)/b19-12- |
| InChIKey | IZBPODRODLOEJS-UNOMPAQXSA-N |
| XLogP | 3.80 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|