C18H21F3N2O3 — CID 3155645
2-[7-ethyl-3-(2,2,2-trifluoroacetyl)indol-1-yl]-N-(3-methoxypropyl)acetamide (PubChem CID 3155645) has the molecular formula C18H21F3N2O3 and a molecular weight of 370.37 g/mol. Its IUPAC name is 2-[7-ethyl-3-(2,2,2-trifluoroacetyl)indol-1-yl]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[7-ethyl-3-(2,2,2-trifluoroacetyl)indol-1-yl]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 3155645 |
| Molecular Formula | C18H21F3N2O3 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 2-[7-ethyl-3-(2,2,2-trifluoroacetyl)indol-1-yl]-N-(3-methoxypropyl)acetamide |
| SMILES | CCc1cccc2c(C(=O)C(F)(F)F)cn(CC(=O)NCCCOC)c12 |
| InChI | InChI=1S/C18H21F3N2O3/c1-3-12-6-4-7-13-14(17(25)18(19,20)21)10-23(16(12)13)11-15(24)22-8-5-9-26-2/h4,6-7,10H,3,5,8-9,11H2,1-2H3,(H,22,24) |
| InChIKey | RWEOFOMFPGJODD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|