C28H21Cl2FN2O2S — CID 126140241
(5Z)-5-[[1-[(2,4-dichlorophenyl)methyl]-7-ethylindol-3-yl]methylidene]-3-[(2-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126140241) has the molecular formula C28H21Cl2FN2O2S and a molecular weight of 539.46 g/mol. Its IUPAC name is (5Z)-5-[[1-[(2,4-dichlorophenyl)methyl]-7-ethylindol-3-yl]methylidene]-3-[(2-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[1-[(2,4-dichlorophenyl)methyl]-7-ethylindol-3-yl]methylidene]-3-[(2-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126140241 |
| Molecular Formula | C28H21Cl2FN2O2S |
| Molecular Weight | 539.46 g/mol |
| Exact Mass | 538.07 |
| IUPAC Name | (5Z)-5-[[1-[(2,4-dichlorophenyl)methyl]-7-ethylindol-3-yl]methylidene]-3-[(2-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCc1cccc2c(/C=C3\SC(=O)N(Cc4ccccc4F)C3=O)cn(Cc3ccc(Cl)cc3Cl)c12 |
| InChI | InChI=1S/C28H21Cl2FN2O2S/c1-2-17-7-5-8-22-20(15-32(26(17)22)14-18-10-11-21(29)13-23(18)30)12-25-27(34)33(28(35)36-25)16-19-6-3-4-9-24(19)31/h3-13,15H,2,14,16H2,1H3/b25-12- |
| InChIKey | NZNOCJLEMUWKBG-ROTLSHHCSA-N |
| XLogP | 7.93 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.46 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|