C29H22Cl2FN3O3S — CID 126142744
2-[(5Z)-5-[[1-[(2,4-dichlorophenyl)methyl]-7-ethylindol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 126142744) has the molecular formula C29H22Cl2FN3O3S and a molecular weight of 582.48 g/mol. Its IUPAC name is 2-[(5Z)-5-[[1-[(2,4-dichlorophenyl)methyl]-7-ethylindol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[(5Z)-5-[[1-[(2,4-dichlorophenyl)methyl]-7-ethylindol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126142744 |
| Molecular Formula | C29H22Cl2FN3O3S |
| Molecular Weight | 582.48 g/mol |
| Exact Mass | 581.07 |
| IUPAC Name | 2-[(5Z)-5-[[1-[(2,4-dichlorophenyl)methyl]-7-ethylindol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | CCc1cccc2c(/C=C3\SC(=O)N(CC(=O)Nc4ccc(F)cc4)C3=O)cn(Cc3ccc(Cl)cc3Cl)c12 |
| InChI | InChI=1S/C29H22Cl2FN3O3S/c1-2-17-4-3-5-23-19(15-34(27(17)23)14-18-6-7-20(30)13-24(18)31)12-25-28(37)35(29(38)39-25)16-26(36)33-22-10-8-21(32)9-11-22/h3-13,15H,2,14,16H2,1H3,(H,33,36)/b25-12- |
| InChIKey | RISHJLHVENLGQR-ROTLSHHCSA-N |
| XLogP | 7.37 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.48 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|