C28H21Cl2N3O4S — CID 126179760
2-[(5E)-5-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-methoxyphenyl)acetamide (PubChem CID 126179760) has the molecular formula C28H21Cl2N3O4S and a molecular weight of 566.47 g/mol. Its IUPAC name is 2-[(5E)-5-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126179760 |
| Molecular Formula | C28H21Cl2N3O4S |
| Molecular Weight | 566.47 g/mol |
| Exact Mass | 565.06 |
| IUPAC Name | 2-[(5E)-5-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CN2C(=O)S/C(=C/c3cn(Cc4ccc(Cl)cc4Cl)c4ccccc34)C2=O)cc1 |
| InChI | InChI=1S/C28H21Cl2N3O4S/c1-37-21-10-8-20(9-11-21)31-26(34)16-33-27(35)25(38-28(33)36)12-18-15-32(24-5-3-2-4-22(18)24)14-17-6-7-19(29)13-23(17)30/h2-13,15H,14,16H2,1H3,(H,31,34)/b25-12+ |
| InChIKey | ISHXYFMDUYPWSC-BRJLIKDPSA-N |
| XLogP | 6.68 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.47 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|