C31H26Cl2N4O4S — CID 126204911
2-[(5E)-5-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide (PubChem CID 126204911) has the molecular formula C31H26Cl2N4O4S and a molecular weight of 621.55 g/mol. Its IUPAC name is 2-[(5E)-5-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 126204911 |
| Molecular Formula | C31H26Cl2N4O4S |
| Molecular Weight | 621.55 g/mol |
| Exact Mass | 620.11 |
| IUPAC Name | 2-[(5E)-5-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C/c2cn(Cc3ccc(Cl)cc3Cl)c3ccccc23)C1=O)Nc1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C31H26Cl2N4O4S/c32-22-10-9-20(24(33)16-22)17-36-18-21(23-5-1-3-7-26(23)36)15-28-30(39)37(31(40)42-28)19-29(38)34-25-6-2-4-8-27(25)35-11-13-41-14-12-35/h1-10,15-16,18H,11-14,17,19H2,(H,34,38)/b28-15+ |
| InChIKey | JRYUNBQFXNHXHB-RWPZCVJISA-N |
| XLogP | 6.51 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.55 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|