C31H28N4O4S — CID 126357540
2-[(5Z)-5-[(1-benzylindol-3-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide (PubChem CID 126357540) has the molecular formula C31H28N4O4S and a molecular weight of 552.66 g/mol. Its IUPAC name is 2-[(5Z)-5-[(1-benzylindol-3-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[(5Z)-5-[(1-benzylindol-3-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 126357540 |
| Molecular Formula | C31H28N4O4S |
| Molecular Weight | 552.66 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | 2-[(5Z)-5-[(1-benzylindol-3-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C\c2cn(Cc3ccccc3)c3ccccc23)C1=O)Nc1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C31H28N4O4S/c36-29(32-25-11-5-7-13-27(25)33-14-16-39-17-15-33)21-35-30(37)28(40-31(35)38)18-23-20-34(19-22-8-2-1-3-9-22)26-12-6-4-10-24(23)26/h1-13,18,20H,14-17,19,21H2,(H,32,36)/b28-18- |
| InChIKey | ZQVIFDUUJSRBJU-VEILYXNESA-N |
| XLogP | 5.20 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.66 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|