C25H24N4O4S — CID 4908465
2-[5-[(1-methylindol-3-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide (PubChem CID 4908465) has the molecular formula C25H24N4O4S and a molecular weight of 476.56 g/mol. Its IUPAC name is 2-[5-[(1-methylindol-3-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[5-[(1-methylindol-3-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 4908465 |
| Molecular Formula | C25H24N4O4S |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | 2-[5-[(1-methylindol-3-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide |
| SMILES | Cn1cc(C=C2SC(=O)N(CC(=O)Nc3ccccc3N3CCOCC3)C2=O)c2ccccc21 |
| InChI | InChI=1S/C25H24N4O4S/c1-27-15-17(18-6-2-4-8-20(18)27)14-22-24(31)29(25(32)34-22)16-23(30)26-19-7-3-5-9-21(19)28-10-12-33-13-11-28/h2-9,14-15H,10-13,16H2,1H3,(H,26,30) |
| InChIKey | NNRLBWNAYLNTLM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|