C27H23N3O7S — CID 126211047
3-[5-[(E)-[3-[2-(2-morpholin-4-ylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 126211047) has the molecular formula C27H23N3O7S and a molecular weight of 533.56 g/mol. Its IUPAC name is 3-[5-[(E)-[3-[2-(2-morpholin-4-ylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 3-[5-[(E)-[3-[2-(2-morpholin-4-ylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 126211047 |
| Molecular Formula | C27H23N3O7S |
| Molecular Weight | 533.56 g/mol |
| Exact Mass | 533.13 |
| IUPAC Name | 3-[5-[(E)-[3-[2-(2-morpholin-4-ylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | O=C(CN1C(=O)S/C(=C/c2ccc(-c3cccc(C(=O)O)c3)o2)C1=O)Nc1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C27H23N3O7S/c31-24(28-20-6-1-2-7-21(20)29-10-12-36-13-11-29)16-30-25(32)23(38-27(30)35)15-19-8-9-22(37-19)17-4-3-5-18(14-17)26(33)34/h1-9,14-15H,10-13,16H2,(H,28,31)(H,33,34)/b23-15+ |
| InChIKey | LIULLLOCWVUTKC-HZHRSRAPSA-N |
| XLogP | 4.16 |
| TPSA | 129.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.56 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_G(7)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|