C27H24N4O7S — CID 126205785
2-[(5E)-5-[[5-(4-methyl-2-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide (PubChem CID 126205785) has the molecular formula C27H24N4O7S and a molecular weight of 548.58 g/mol. Its IUPAC name is 2-[(5E)-5-[[5-(4-methyl-2-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[5-(4-methyl-2-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 126205785 |
| Molecular Formula | C27H24N4O7S |
| Molecular Weight | 548.58 g/mol |
| Exact Mass | 548.14 |
| IUPAC Name | 2-[(5E)-5-[[5-(4-methyl-2-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide |
| SMILES | Cc1ccc(-c2ccc(/C=C3/SC(=O)N(CC(=O)Nc4ccccc4N4CCOCC4)C3=O)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H24N4O7S/c1-17-6-8-19(22(14-17)31(35)36)23-9-7-18(38-23)15-24-26(33)30(27(34)39-24)16-25(32)28-20-4-2-3-5-21(20)29-10-12-37-13-11-29/h2-9,14-15H,10-13,16H2,1H3,(H,28,32)/b24-15+ |
| InChIKey | PBSMKHSQZJNSTD-BUVRLJJBSA-N |
| XLogP | 4.67 |
| TPSA | 135.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.58 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|