C22H20BrN3O4S — CID 126210068
2-[(5E)-5-[(4-bromophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide (PubChem CID 126210068) has the molecular formula C22H20BrN3O4S and a molecular weight of 502.39 g/mol. Its IUPAC name is 2-[(5E)-5-[(4-bromophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[(4-bromophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 126210068 |
| Molecular Formula | C22H20BrN3O4S |
| Molecular Weight | 502.39 g/mol |
| Exact Mass | 501.04 |
| IUPAC Name | 2-[(5E)-5-[(4-bromophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C/c2ccc(Br)cc2)C1=O)Nc1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C22H20BrN3O4S/c23-16-7-5-15(6-8-16)13-19-21(28)26(22(29)31-19)14-20(27)24-17-3-1-2-4-18(17)25-9-11-30-12-10-25/h1-8,13H,9-12,14H2,(H,24,27)/b19-13+ |
| InChIKey | ZWZRDJJEOWUPMQ-CPNJWEJPSA-N |
| XLogP | 3.96 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|