C29H26N4O9S2 — CID 126201648
[4-[(Z)-[3-[2-(2-morpholin-4-ylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methyl-3-nitrobenzenesulfonate (PubChem CID 126201648) has the molecular formula C29H26N4O9S2 and a molecular weight of 638.68 g/mol. Its IUPAC name is [4-[(Z)-[3-[2-(2-morpholin-4-ylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methyl-3-nitrobenzenesulfonate.
| Compound Name | [4-[(Z)-[3-[2-(2-morpholin-4-ylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methyl-3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 126201648 |
| Molecular Formula | C29H26N4O9S2 |
| Molecular Weight | 638.68 g/mol |
| Exact Mass | 638.11 |
| IUPAC Name | [4-[(Z)-[3-[2-(2-morpholin-4-ylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methyl-3-nitrobenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(/C=C3\SC(=O)N(CC(=O)Nc4ccccc4N4CCOCC4)C3=O)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H26N4O9S2/c1-19-6-11-22(17-25(19)33(37)38)44(39,40)42-21-9-7-20(8-10-21)16-26-28(35)32(29(36)43-26)18-27(34)30-23-4-2-3-5-24(23)31-12-14-41-15-13-31/h2-11,16-17H,12-15,18H2,1H3,(H,30,34)/b26-16- |
| InChIKey | PXJGNVWTCXUUPV-QQXSKIMKSA-N |
| XLogP | 4.18 |
| TPSA | 165.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.68 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|