C26H21N3O8S3 — CID 126164990
[4-[(Z)-[3-[2-(3-methylsulfanylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methyl-3-nitrobenzenesulfonate (PubChem CID 126164990) has the molecular formula C26H21N3O8S3 and a molecular weight of 599.67 g/mol. Its IUPAC name is [4-[(Z)-[3-[2-(3-methylsulfanylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methyl-3-nitrobenzenesulfonate.
| Compound Name | [4-[(Z)-[3-[2-(3-methylsulfanylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methyl-3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 126164990 |
| Molecular Formula | C26H21N3O8S3 |
| Molecular Weight | 599.67 g/mol |
| Exact Mass | 599.05 |
| IUPAC Name | [4-[(Z)-[3-[2-(3-methylsulfanylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methyl-3-nitrobenzenesulfonate |
| SMILES | CSc1cccc(NC(=O)CN2C(=O)S/C(=C\c3ccc(OS(=O)(=O)c4ccc(C)c([N+](=O)[O-])c4)cc3)C2=O)c1 |
| InChI | InChI=1S/C26H21N3O8S3/c1-16-6-11-21(14-22(16)29(33)34)40(35,36)37-19-9-7-17(8-10-19)12-23-25(31)28(26(32)39-23)15-24(30)27-18-4-3-5-20(13-18)38-2/h3-14H,15H2,1-2H3,(H,27,30)/b23-12- |
| InChIKey | YIZJRFYPEVRCIN-FMCGGJTJSA-N |
| XLogP | 5.07 |
| TPSA | 152.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.67 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|