C28H23N3O11S2 — CID 126203352
[4-[(Z)-[3-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] 4-methyl-3-nitrobenzenesulfonate (PubChem CID 126203352) has the molecular formula C28H23N3O11S2 and a molecular weight of 641.64 g/mol. Its IUPAC name is [4-[(Z)-[3-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] 4-methyl-3-nitrobenzenesulfonate.
| Compound Name | [4-[(Z)-[3-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] 4-methyl-3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 126203352 |
| Molecular Formula | C28H23N3O11S2 |
| Molecular Weight | 641.64 g/mol |
| Exact Mass | 641.08 |
| IUPAC Name | [4-[(Z)-[3-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenyl] 4-methyl-3-nitrobenzenesulfonate |
| SMILES | COc1cc(/C=C2\SC(=O)N(CC(=O)Nc3ccc4c(c3)OCCO4)C2=O)ccc1OS(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H23N3O11S2/c1-16-3-6-19(14-20(16)31(35)36)44(37,38)42-22-7-4-17(11-23(22)39-2)12-25-27(33)30(28(34)43-25)15-26(32)29-18-5-8-21-24(13-18)41-10-9-40-21/h3-8,11-14H,9-10,15H2,1-2H3,(H,29,32)/b25-12- |
| InChIKey | WPJHKVJDOQRHLZ-ROTLSHHCSA-N |
| XLogP | 4.13 |
| TPSA | 180.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.64 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|