C27H23N3O8S2 — CID 126279850
[4-[(Z)-[3-[2-(3,5-dimethylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methyl-3-nitrobenzenesulfonate (PubChem CID 126279850) has the molecular formula C27H23N3O8S2 and a molecular weight of 581.63 g/mol. Its IUPAC name is [4-[(Z)-[3-[2-(3,5-dimethylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methyl-3-nitrobenzenesulfonate.
| Compound Name | [4-[(Z)-[3-[2-(3,5-dimethylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methyl-3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 126279850 |
| Molecular Formula | C27H23N3O8S2 |
| Molecular Weight | 581.63 g/mol |
| Exact Mass | 581.09 |
| IUPAC Name | [4-[(Z)-[3-[2-(3,5-dimethylanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-methyl-3-nitrobenzenesulfonate |
| SMILES | Cc1cc(C)cc(NC(=O)CN2C(=O)S/C(=C\c3ccc(OS(=O)(=O)c4ccc(C)c([N+](=O)[O-])c4)cc3)C2=O)c1 |
| InChI | InChI=1S/C27H23N3O8S2/c1-16-10-17(2)12-20(11-16)28-25(31)15-29-26(32)24(39-27(29)33)13-19-5-7-21(8-6-19)38-40(36,37)22-9-4-18(3)23(14-22)30(34)35/h4-14H,15H2,1-3H3,(H,28,31)/b24-13- |
| InChIKey | LAYDERVGIORIEO-CFRMEGHHSA-N |
| XLogP | 4.96 |
| TPSA | 152.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.63 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|