C23H22N2O9S2 — CID 126199290
butyl 2-[(5Z)-5-[[4-(4-methyl-3-nitrophenyl)sulfonyloxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 126199290) has the molecular formula C23H22N2O9S2 and a molecular weight of 534.57 g/mol. Its IUPAC name is butyl 2-[(5Z)-5-[[4-(4-methyl-3-nitrophenyl)sulfonyloxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | butyl 2-[(5Z)-5-[[4-(4-methyl-3-nitrophenyl)sulfonyloxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 126199290 |
| Molecular Formula | C23H22N2O9S2 |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 534.08 |
| IUPAC Name | butyl 2-[(5Z)-5-[[4-(4-methyl-3-nitrophenyl)sulfonyloxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCCCOC(=O)CN1C(=O)S/C(=C\c2ccc(OS(=O)(=O)c3ccc(C)c([N+](=O)[O-])c3)cc2)C1=O |
| InChI | InChI=1S/C23H22N2O9S2/c1-3-4-11-33-21(26)14-24-22(27)20(35-23(24)28)12-16-6-8-17(9-7-16)34-36(31,32)18-10-5-15(2)19(13-18)25(29)30/h5-10,12-13H,3-4,11,14H2,1-2H3/b20-12- |
| InChIKey | AXLJGIBWTNRIJI-NDENLUEZSA-N |
| XLogP | 4.05 |
| TPSA | 150.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|