C20H16N2O7S — CID 3908393
N-(1,3-benzodioxol-5-yl)-2-[5-[(3-hydroxy-4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 3908393) has the molecular formula C20H16N2O7S and a molecular weight of 428.42 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[5-[(3-hydroxy-4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[5-[(3-hydroxy-4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 3908393 |
| Molecular Formula | C20H16N2O7S |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[5-[(3-hydroxy-4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | COc1ccc(C=C2SC(=O)N(CC(=O)Nc3ccc4c(c3)OCO4)C2=O)cc1O |
| InChI | InChI=1S/C20H16N2O7S/c1-27-14-4-2-11(6-13(14)23)7-17-19(25)22(20(26)30-17)9-18(24)21-12-3-5-15-16(8-12)29-10-28-15/h2-8,23H,9-10H2,1H3,(H,21,24) |
| InChIKey | IGPYWEFJPKHNSD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|