C21H17N3O6S — CID 126167529
2-[(5Z)-5-[(4-acetamidophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(1,3-benzodioxol-5-yl)acetamide (PubChem CID 126167529) has the molecular formula C21H17N3O6S and a molecular weight of 439.45 g/mol. Its IUPAC name is 2-[(5Z)-5-[(4-acetamidophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(1,3-benzodioxol-5-yl)acetamide.
| Compound Name | 2-[(5Z)-5-[(4-acetamidophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(1,3-benzodioxol-5-yl)acetamide |
|---|---|
| PubChem CID | 126167529 |
| Molecular Formula | C21H17N3O6S |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | 2-[(5Z)-5-[(4-acetamidophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(1,3-benzodioxol-5-yl)acetamide |
| SMILES | CC(=O)Nc1ccc(/C=C2\SC(=O)N(CC(=O)Nc3ccc4c(c3)OCO4)C2=O)cc1 |
| InChI | InChI=1S/C21H17N3O6S/c1-12(25)22-14-4-2-13(3-5-14)8-18-20(27)24(21(28)31-18)10-19(26)23-15-6-7-16-17(9-15)30-11-29-16/h2-9H,10-11H2,1H3,(H,22,25)(H,23,26)/b18-8- |
| InChIKey | ZVCTYENQXOYXHJ-LSCVHKIXSA-N |
| XLogP | 3.05 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|