C27H22N2O7S — CID 126163618
N-(1,3-benzodioxol-5-yl)-2-[(5E)-2,4-dioxo-5-[[4-(2-phenoxyethoxy)phenyl]methylidene]-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126163618) has the molecular formula C27H22N2O7S and a molecular weight of 518.55 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[(5E)-2,4-dioxo-5-[[4-(2-phenoxyethoxy)phenyl]methylidene]-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[(5E)-2,4-dioxo-5-[[4-(2-phenoxyethoxy)phenyl]methylidene]-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126163618 |
| Molecular Formula | C27H22N2O7S |
| Molecular Weight | 518.55 g/mol |
| Exact Mass | 518.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[(5E)-2,4-dioxo-5-[[4-(2-phenoxyethoxy)phenyl]methylidene]-1,3-thiazolidin-3-yl]acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C/c2ccc(OCCOc3ccccc3)cc2)C1=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C27H22N2O7S/c30-25(28-19-8-11-22-23(15-19)36-17-35-22)16-29-26(31)24(37-27(29)32)14-18-6-9-21(10-7-18)34-13-12-33-20-4-2-1-3-5-20/h1-11,14-15H,12-13,16-17H2,(H,28,30)/b24-14+ |
| InChIKey | MJUUXPKHMUNFOE-ZVHZXABRSA-N |
| XLogP | 4.55 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.55 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|