C28H24N2O6S — CID 126203632
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[(5E)-5-[[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126203632) has the molecular formula C28H24N2O6S and a molecular weight of 516.58 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[(5E)-5-[[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[(5E)-5-[[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126203632 |
| Molecular Formula | C28H24N2O6S |
| Molecular Weight | 516.58 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[(5E)-5-[[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | Cc1cccc(COc2ccc(/C=C3/SC(=O)N(CC(=O)Nc4ccc5c(c4)OCCO5)C3=O)cc2)c1 |
| InChI | InChI=1S/C28H24N2O6S/c1-18-3-2-4-20(13-18)17-36-22-8-5-19(6-9-22)14-25-27(32)30(28(33)37-25)16-26(31)29-21-7-10-23-24(15-21)35-12-11-34-23/h2-10,13-15H,11-12,16-17H2,1H3,(H,29,31)/b25-14+ |
| InChIKey | DTNNDICFACDTNN-AFUMVMLFSA-N |
| XLogP | 5.02 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.58 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|