C19H12I2N2O6S — CID 126182076
N-(1,3-benzodioxol-5-yl)-2-[(5E)-5-[(4-hydroxy-3,5-diiodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126182076) has the molecular formula C19H12I2N2O6S and a molecular weight of 650.19 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[(5E)-5-[(4-hydroxy-3,5-diiodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[(5E)-5-[(4-hydroxy-3,5-diiodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126182076 |
| Molecular Formula | C19H12I2N2O6S |
| Molecular Weight | 650.19 g/mol |
| Exact Mass | 649.85 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[(5E)-5-[(4-hydroxy-3,5-diiodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C/c2cc(I)c(O)c(I)c2)C1=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H12I2N2O6S/c20-11-3-9(4-12(21)17(11)25)5-15-18(26)23(19(27)30-15)7-16(24)22-10-1-2-13-14(6-10)29-8-28-13/h1-6,25H,7-8H2,(H,22,24)/b15-5+ |
| InChIKey | VATBHLSYJWMTBL-PJQLUOCWSA-N |
| XLogP | 4.01 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.19 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|