C18H16N2O3S3 — CID 126171574
N-(3-methylsulfanylphenyl)-2-[(5E)-5-[(3-methylthiophen-2-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126171574) has the molecular formula C18H16N2O3S3 and a molecular weight of 404.54 g/mol. Its IUPAC name is N-(3-methylsulfanylphenyl)-2-[(5E)-5-[(3-methylthiophen-2-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(3-methylsulfanylphenyl)-2-[(5E)-5-[(3-methylthiophen-2-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126171574 |
| Molecular Formula | C18H16N2O3S3 |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | N-(3-methylsulfanylphenyl)-2-[(5E)-5-[(3-methylthiophen-2-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | CSc1cccc(NC(=O)CN2C(=O)S/C(=C/c3sccc3C)C2=O)c1 |
| InChI | InChI=1S/C18H16N2O3S3/c1-11-6-7-25-14(11)9-15-17(22)20(18(23)26-15)10-16(21)19-12-4-3-5-13(8-12)24-2/h3-9H,10H2,1-2H3,(H,19,21)/b15-9+ |
| InChIKey | VZRAQMYAARHMKK-OQLLNIDSSA-N |
| XLogP | 4.45 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|