C33H29N3O5S — CID 126212987
N-(2-morpholin-4-ylphenyl)-2-[(5Z)-5-[[4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126212987) has the molecular formula C33H29N3O5S and a molecular weight of 579.68 g/mol. Its IUPAC name is N-(2-morpholin-4-ylphenyl)-2-[(5Z)-5-[[4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(2-morpholin-4-ylphenyl)-2-[(5Z)-5-[[4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126212987 |
| Molecular Formula | C33H29N3O5S |
| Molecular Weight | 579.68 g/mol |
| Exact Mass | 579.18 |
| IUPAC Name | N-(2-morpholin-4-ylphenyl)-2-[(5Z)-5-[[4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C\c2ccc(OCc3ccc4ccccc4c3)cc2)C1=O)Nc1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C33H29N3O5S/c37-31(34-28-7-3-4-8-29(28)35-15-17-40-18-16-35)21-36-32(38)30(42-33(36)39)20-23-10-13-27(14-11-23)41-22-24-9-12-25-5-1-2-6-26(25)19-24/h1-14,19-20H,15-18,21-22H2,(H,34,37)/b30-20- |
| InChIKey | XPUXPBIBDHZHHY-COEJQBHMSA-N |
| XLogP | 5.93 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.68 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|