C30H28FN3O6S — CID 126213273
2-[(5Z)-5-[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide (PubChem CID 126213273) has the molecular formula C30H28FN3O6S and a molecular weight of 577.63 g/mol. Its IUPAC name is 2-[(5Z)-5-[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[(5Z)-5-[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 126213273 |
| Molecular Formula | C30H28FN3O6S |
| Molecular Weight | 577.63 g/mol |
| Exact Mass | 577.17 |
| IUPAC Name | 2-[(5Z)-5-[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide |
| SMILES | COc1cc(/C=C2\SC(=O)N(CC(=O)Nc3ccccc3N3CCOCC3)C2=O)ccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C30H28FN3O6S/c1-38-26-16-21(8-11-25(26)40-19-20-6-9-22(31)10-7-20)17-27-29(36)34(30(37)41-27)18-28(35)32-23-4-2-3-5-24(23)33-12-14-39-15-13-33/h2-11,16-17H,12-15,18-19H2,1H3,(H,32,35)/b27-17- |
| InChIKey | ZRVNRDAJWYNXGB-PKAZHMFMSA-N |
| XLogP | 4.92 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.63 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|