C25H25N5O5S — CID 1283148
2-[(5E)-5-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide (PubChem CID 1283148) has the molecular formula C25H25N5O5S and a molecular weight of 507.57 g/mol. Its IUPAC name is 2-[(5E)-5-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 1283148 |
| Molecular Formula | C25H25N5O5S |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | 2-[(5E)-5-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide |
| SMILES | Cn1c(=O)n(C)c2cc(/C=C3/SC(=O)N(CC(=O)Nc4ccccc4N4CCOCC4)C3=O)ccc21 |
| InChI | InChI=1S/C25H25N5O5S/c1-27-19-8-7-16(13-20(19)28(2)24(27)33)14-21-23(32)30(25(34)36-21)15-22(31)26-17-5-3-4-6-18(17)29-9-11-35-12-10-29/h3-8,13-14H,9-12,15H2,1-2H3,(H,26,31)/b21-14+ |
| InChIKey | OXTABWYEJOHXPJ-KGENOOAVSA-N |
| XLogP | 2.39 |
| TPSA | 105.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|