C32H31ClN4O7S — CID 126210331
2-[(5E)-5-[[4-[2-(3-chloroanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide (PubChem CID 126210331) has the molecular formula C32H31ClN4O7S and a molecular weight of 651.14 g/mol. Its IUPAC name is 2-[(5E)-5-[[4-[2-(3-chloroanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[4-[2-(3-chloroanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 126210331 |
| Molecular Formula | C32H31ClN4O7S |
| Molecular Weight | 651.14 g/mol |
| Exact Mass | 650.16 |
| IUPAC Name | 2-[(5E)-5-[[4-[2-(3-chloroanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CC(=O)Nc3ccccc3N3CCOCC3)C2=O)ccc1OCC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C32H31ClN4O7S/c1-2-43-27-16-21(10-11-26(27)44-20-30(39)34-23-7-5-6-22(33)18-23)17-28-31(40)37(32(41)45-28)19-29(38)35-24-8-3-4-9-25(24)36-12-14-42-15-13-36/h3-11,16-18H,2,12-15,19-20H2,1H3,(H,34,39)(H,35,38)/b28-17+ |
| InChIKey | BITZGNJARJWGFX-OGLMXYFKSA-N |
| XLogP | 5.27 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.14 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|