C29H25I2N3O5S — CID 126203440
2-[(5E)-5-[(3,5-diiodo-2-phenylmethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide (PubChem CID 126203440) has the molecular formula C29H25I2N3O5S and a molecular weight of 781.41 g/mol. Its IUPAC name is 2-[(5E)-5-[(3,5-diiodo-2-phenylmethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[(3,5-diiodo-2-phenylmethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 126203440 |
| Molecular Formula | C29H25I2N3O5S |
| Molecular Weight | 781.41 g/mol |
| Exact Mass | 780.96 |
| IUPAC Name | 2-[(5E)-5-[(3,5-diiodo-2-phenylmethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C/c2cc(I)cc(I)c2OCc2ccccc2)C1=O)Nc1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C29H25I2N3O5S/c30-21-14-20(27(22(31)16-21)39-18-19-6-2-1-3-7-19)15-25-28(36)34(29(37)40-25)17-26(35)32-23-8-4-5-9-24(23)33-10-12-38-13-11-33/h1-9,14-16H,10-13,17-18H2,(H,32,35)/b25-15+ |
| InChIKey | YTEPZUPIFRDRMM-MFKUBSTISA-N |
| XLogP | 5.99 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.41 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|