C25H22ClN3O4S — CID 124664053
(5E)-5-[[1-[(4-chlorophenyl)methyl]indol-3-yl]methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 124664053) has the molecular formula C25H22ClN3O4S and a molecular weight of 495.99 g/mol. Its IUPAC name is (5E)-5-[[1-[(4-chlorophenyl)methyl]indol-3-yl]methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[1-[(4-chlorophenyl)methyl]indol-3-yl]methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124664053 |
| Molecular Formula | C25H22ClN3O4S |
| Molecular Weight | 495.99 g/mol |
| Exact Mass | 495.10 |
| IUPAC Name | (5E)-5-[[1-[(4-chlorophenyl)methyl]indol-3-yl]methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)S/C(=C/c2cn(Cc3ccc(Cl)cc3)c3ccccc23)C1=O)N1CCOCC1 |
| InChI | InChI=1S/C25H22ClN3O4S/c26-19-7-5-17(6-8-19)14-28-15-18(20-3-1-2-4-21(20)28)13-22-24(31)29(25(32)34-22)16-23(30)27-9-11-33-12-10-27/h1-8,13,15H,9-12,14,16H2/b22-13+ |
| InChIKey | GKAQFUAFCHOFOS-LPYMAVHISA-N |
| XLogP | 4.24 |
| TPSA | 71.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.99 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|